C12H15NO2 — CID 13330478
2,4,4-trimethyl-3-phenyl-1,2-oxazolidin-5-one (PubChem CID 13330478) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-phenyl-1,2-oxazolidin-5-one.
| Compound Name | 2,4,4-trimethyl-3-phenyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 13330478 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,4,4-trimethyl-3-phenyl-1,2-oxazolidin-5-one |
| SMILES | CN1OC(=O)C(C)(C)C1c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-12(2)10(13(3)15-11(12)14)9-7-5-4-6-8-9/h4-8,10H,1-3H3 |
| InChIKey | JESSKIFNTGUVAO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |