C18H21N5O5 — CID 133305531
1-[2-(methylcarbamoyl)-4-nitrophenyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide (PubChem CID 133305531) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-[2-(methylcarbamoyl)-4-nitrophenyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(methylcarbamoyl)-4-nitrophenyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133305531 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[2-(methylcarbamoyl)-4-nitrophenyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1N1CCC(C(=O)Nc2cc(C)on2)CC1 |
| InChI | InChI=1S/C18H21N5O5/c1-11-9-16(21-28-11)20-17(24)12-5-7-22(8-6-12)15-4-3-13(23(26)27)10-14(15)18(25)19-2/h3-4,9-10,12H,5-8H2,1-2H3,(H,19,25)(H,20,21,24) |
| InChIKey | JDCGPAMBBQMCTP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|