C19H21N5O2 — CID 133305848
4-(4-but-3-ynylpiperazin-1-yl)-6-methyl-2-(3-nitrophenyl)pyrimidine (PubChem CID 133305848) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-(4-but-3-ynylpiperazin-1-yl)-6-methyl-2-(3-nitrophenyl)pyrimidine.
| Compound Name | 4-(4-but-3-ynylpiperazin-1-yl)-6-methyl-2-(3-nitrophenyl)pyrimidine |
|---|---|
| PubChem CID | 133305848 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-(4-but-3-ynylpiperazin-1-yl)-6-methyl-2-(3-nitrophenyl)pyrimidine |
| SMILES | C#CCCN1CCN(c2cc(C)nc(-c3cccc([N+](=O)[O-])c3)n2)CC1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-4-8-22-9-11-23(12-10-22)18-13-15(2)20-19(21-18)16-6-5-7-17(14-16)24(25)26/h1,5-7,13-14H,4,8-12H2,2H3 |
| InChIKey | WWSLTAXEJLGCAC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|