C21H22N4O4S — CID 133306596
N-(1-benzylsulfonylpiperidin-4-yl)-6-nitroquinolin-2-amine (PubChem CID 133306596) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is N-(1-benzylsulfonylpiperidin-4-yl)-6-nitroquinolin-2-amine.
| Compound Name | N-(1-benzylsulfonylpiperidin-4-yl)-6-nitroquinolin-2-amine |
|---|---|
| PubChem CID | 133306596 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-(1-benzylsulfonylpiperidin-4-yl)-6-nitroquinolin-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NC3CCN(S(=O)(=O)Cc4ccccc4)CC3)ccc2c1 |
| InChI | InChI=1S/C21H22N4O4S/c26-25(27)19-7-8-20-17(14-19)6-9-21(23-20)22-18-10-12-24(13-11-18)30(28,29)15-16-4-2-1-3-5-16/h1-9,14,18H,10-13,15H2,(H,22,23) |
| InChIKey | OTTJQHJHICGDLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|