C17H24N6S — CID 133307184
6-methylsulfanyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyridazin-3-amine (PubChem CID 133307184) has the molecular formula C17H24N6S and a molecular weight of 344.49 g/mol. Its IUPAC name is 6-methylsulfanyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyridazin-3-amine.
| Compound Name | 6-methylsulfanyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 133307184 |
| Molecular Formula | C17H24N6S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 6-methylsulfanyl-N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]pyridazin-3-amine |
| SMILES | CSc1ccc(NC(C)CN2CCN(c3ccccn3)CC2)nn1 |
| InChI | InChI=1S/C17H24N6S/c1-14(19-15-6-7-17(24-2)21-20-15)13-22-9-11-23(12-10-22)16-5-3-4-8-18-16/h3-8,14H,9-13H2,1-2H3,(H,19,20) |
| InChIKey | STCGAKOEDFZTMY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |