C18H22F3N5 — CID 133307275
N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 133307275) has the molecular formula C18H22F3N5 and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133307275 |
| Molecular Formula | C18H22F3N5 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(CN1CCN(c2ccccn2)CC1)Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H22F3N5/c1-14(24-16-6-5-15(12-23-16)18(19,20)21)13-25-8-10-26(11-9-25)17-4-2-3-7-22-17/h2-7,12,14H,8-11,13H2,1H3,(H,23,24) |
| InChIKey | HLKCMLDGHBSJEL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |