C13H10ClN5O3 — CID 133308021
methyl 2-[4-[(2-chloro-3-pyridinyl)oxy]pyrazolo[5,4-d]pyrimidin-1-yl]acetate (PubChem CID 133308021) has the molecular formula C13H10ClN5O3 and a molecular weight of 319.71 g/mol. Its IUPAC name is methyl 2-[4-[(2-chloro-3-pyridinyl)oxy]pyrazolo[5,4-d]pyrimidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(2-chloro-3-pyridinyl)oxy]pyrazolo[5,4-d]pyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 133308021 |
| Molecular Formula | C13H10ClN5O3 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl 2-[4-[(2-chloro-3-pyridinyl)oxy]pyrazolo[5,4-d]pyrimidin-1-yl]acetate |
| SMILES | COC(=O)Cn1ncc2c(Oc3cccnc3Cl)ncnc21 |
| InChI | InChI=1S/C13H10ClN5O3/c1-21-10(20)6-19-12-8(5-18-19)13(17-7-16-12)22-9-3-2-4-15-11(9)14/h2-5,7H,6H2,1H3 |
| InChIKey | VRQAVZARZMSNFQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|