C18H22FN3S — CID 133311303
3-ethylsulfanyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]azepane (PubChem CID 133311303) has the molecular formula C18H22FN3S and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]azepane.
| Compound Name | 3-ethylsulfanyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]azepane |
|---|---|
| PubChem CID | 133311303 |
| Molecular Formula | C18H22FN3S |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-ethylsulfanyl-1-[6-(4-fluorophenyl)pyridazin-3-yl]azepane |
| SMILES | CCSC1CCCCN(c2ccc(-c3ccc(F)cc3)nn2)C1 |
| InChI | InChI=1S/C18H22FN3S/c1-2-23-16-5-3-4-12-22(13-16)18-11-10-17(20-21-18)14-6-8-15(19)9-7-14/h6-11,16H,2-5,12-13H2,1H3 |
| InChIKey | SERABWBTRJNAKV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |