C13H23N3 — CID 133311807
N-(5,5-dimethylhexan-2-yl)-6-methylpyrimidin-4-amine (PubChem CID 133311807) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N-(5,5-dimethylhexan-2-yl)-6-methylpyrimidin-4-amine.
| Compound Name | N-(5,5-dimethylhexan-2-yl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133311807 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N-(5,5-dimethylhexan-2-yl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NC(C)CCC(C)(C)C)ncn1 |
| InChI | InChI=1S/C13H23N3/c1-10(6-7-13(3,4)5)16-12-8-11(2)14-9-15-12/h8-10H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | PXFKLFJMEABOIZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |