C11H20N4 — CID 106357708
4-methyl-3-N-(6-methylpyrimidin-4-yl)pentane-1,3-diamine (PubChem CID 106357708) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-methyl-3-N-(6-methylpyrimidin-4-yl)pentane-1,3-diamine.
| Compound Name | 4-methyl-3-N-(6-methylpyrimidin-4-yl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 106357708 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-methyl-3-N-(6-methylpyrimidin-4-yl)pentane-1,3-diamine |
| SMILES | Cc1cc(NC(CCN)C(C)C)ncn1 |
| InChI | InChI=1S/C11H20N4/c1-8(2)10(4-5-12)15-11-6-9(3)13-7-14-11/h6-8,10H,4-5,12H2,1-3H3,(H,13,14,15) |
| InChIKey | GTKXIDOGWTXDRD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |