C11H20N4O — CID 56708033
(2S)-2-[[6-(2-aminoethyl)pyrimidin-4-yl]amino]-3-methylbutan-1-ol (PubChem CID 56708033) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is (2S)-2-[[6-(2-aminoethyl)pyrimidin-4-yl]amino]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-[[6-(2-aminoethyl)pyrimidin-4-yl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 56708033 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (2S)-2-[[6-(2-aminoethyl)pyrimidin-4-yl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)Nc1cc(CCN)ncn1 |
| InChI | InChI=1S/C11H20N4O/c1-8(2)10(6-16)15-11-5-9(3-4-12)13-7-14-11/h5,7-8,10,16H,3-4,6,12H2,1-2H3,(H,13,14,15)/t10-/m1/s1 |
| InChIKey | DKYTWBRGVWMSRS-SNVBAGLBSA-N |
| XLogP | 0.41 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |