C14H20N4 — CID 114178266
4-methyl-3-N-quinazolin-4-ylpentane-1,3-diamine (PubChem CID 114178266) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-methyl-3-N-quinazolin-4-ylpentane-1,3-diamine.
| Compound Name | 4-methyl-3-N-quinazolin-4-ylpentane-1,3-diamine |
|---|---|
| PubChem CID | 114178266 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-methyl-3-N-quinazolin-4-ylpentane-1,3-diamine |
| SMILES | CC(C)C(CCN)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C14H20N4/c1-10(2)12(7-8-15)18-14-11-5-3-4-6-13(11)16-9-17-14/h3-6,9-10,12H,7-8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | UEXRLEILTCQDHJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |