C13H19N3S — CID 106357564
3-N-(2,1-benzothiazol-3-yl)-4-methylpentane-1,3-diamine (PubChem CID 106357564) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-N-(2,1-benzothiazol-3-yl)-4-methylpentane-1,3-diamine.
| Compound Name | 3-N-(2,1-benzothiazol-3-yl)-4-methylpentane-1,3-diamine |
|---|---|
| PubChem CID | 106357564 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-N-(2,1-benzothiazol-3-yl)-4-methylpentane-1,3-diamine |
| SMILES | CC(C)C(CCN)Nc1snc2ccccc12 |
| InChI | InChI=1S/C13H19N3S/c1-9(2)11(7-8-14)15-13-10-5-3-4-6-12(10)16-17-13/h3-6,9,11,15H,7-8,14H2,1-2H3 |
| InChIKey | IEUQOKHJFWKOLO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |