C14H16N2S — CID 66355508
N-(dicyclopropylmethyl)-2,1-benzothiazol-3-amine (PubChem CID 66355508) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(dicyclopropylmethyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 66355508 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(dicyclopropylmethyl)-2,1-benzothiazol-3-amine |
| SMILES | c1ccc2c(NC(C3CC3)C3CC3)snc2c1 |
| InChI | InChI=1S/C14H16N2S/c1-2-4-12-11(3-1)14(17-16-12)15-13(9-5-6-9)10-7-8-10/h1-4,9-10,13,15H,5-8H2 |
| InChIKey | GCUJRAXQCLEADI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |