C15H13ClN2S — CID 63372965
N-[1-(3-chlorophenyl)ethyl]-2,1-benzothiazol-3-amine (PubChem CID 63372965) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-2,1-benzothiazol-3-amine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 63372965 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-2,1-benzothiazol-3-amine |
| SMILES | CC(Nc1snc2ccccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN2S/c1-10(11-5-4-6-12(16)9-11)17-15-13-7-2-3-8-14(13)18-19-15/h2-10,17H,1H3 |
| InChIKey | JLDHUWSPYRMUAN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |