C12H14N2O2S — CID 66355714
ethyl 2-(2,1-benzothiazol-3-ylamino)propanoate (PubChem CID 66355714) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl 2-(2,1-benzothiazol-3-ylamino)propanoate.
| Compound Name | ethyl 2-(2,1-benzothiazol-3-ylamino)propanoate |
|---|---|
| PubChem CID | 66355714 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | ethyl 2-(2,1-benzothiazol-3-ylamino)propanoate |
| SMILES | CCOC(=O)C(C)Nc1snc2ccccc12 |
| InChI | InChI=1S/C12H14N2O2S/c1-3-16-12(15)8(2)13-11-9-6-4-5-7-10(9)14-17-11/h4-8,13H,3H2,1-2H3 |
| InChIKey | XUFUJADLXNUSSR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |