C11H14N2OS — CID 102699127
N-(2-methoxypropyl)-2,1-benzothiazol-3-amine (PubChem CID 102699127) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(2-methoxypropyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(2-methoxypropyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 102699127 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2-methoxypropyl)-2,1-benzothiazol-3-amine |
| SMILES | COC(C)CNc1snc2ccccc12 |
| InChI | InChI=1S/C11H14N2OS/c1-8(14-2)7-12-11-9-5-3-4-6-10(9)13-15-11/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | LMCVIYDSFVPYKG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |