C16H22N4S — CID 133316495
5,6-dimethyl-N-(4-methylsulfanylbutyl)-2-pyridin-4-ylpyrimidin-4-amine (PubChem CID 133316495) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 5,6-dimethyl-N-(4-methylsulfanylbutyl)-2-pyridin-4-ylpyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-N-(4-methylsulfanylbutyl)-2-pyridin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133316495 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5,6-dimethyl-N-(4-methylsulfanylbutyl)-2-pyridin-4-ylpyrimidin-4-amine |
| SMILES | CSCCCCNc1nc(-c2ccncc2)nc(C)c1C |
| InChI | InChI=1S/C16H22N4S/c1-12-13(2)19-16(14-6-9-17-10-7-14)20-15(12)18-8-4-5-11-21-3/h6-7,9-10H,4-5,8,11H2,1-3H3,(H,18,19,20) |
| InChIKey | HZWBMESRZOEJOT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|