C19H20N4O2 — CID 133349530
4-[2-[(5,6-dimethyl-2-pyridin-4-ylpyrimidin-4-yl)amino]ethyl]benzene-1,2-diol (PubChem CID 133349530) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-[2-[(5,6-dimethyl-2-pyridin-4-ylpyrimidin-4-yl)amino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[(5,6-dimethyl-2-pyridin-4-ylpyrimidin-4-yl)amino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 133349530 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[2-[(5,6-dimethyl-2-pyridin-4-ylpyrimidin-4-yl)amino]ethyl]benzene-1,2-diol |
| SMILES | Cc1nc(-c2ccncc2)nc(NCCc2ccc(O)c(O)c2)c1C |
| InChI | InChI=1S/C19H20N4O2/c1-12-13(2)22-19(15-6-8-20-9-7-15)23-18(12)21-10-5-14-3-4-16(24)17(25)11-14/h3-4,6-9,11,24-25H,5,10H2,1-2H3,(H,21,22,23) |
| InChIKey | WQMIQGHJHNJQEV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|