C17H21N3O2 — CID 133461658
4-[2-[(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]ethyl]benzene-1,2-diol (PubChem CID 133461658) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[2-[(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 133461658 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-[2-[(2-methyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]ethyl]benzene-1,2-diol |
| SMILES | Cc1nc2c(c(NCCc3ccc(O)c(O)c3)n1)CCCC2 |
| InChI | InChI=1S/C17H21N3O2/c1-11-19-14-5-3-2-4-13(14)17(20-11)18-9-8-12-6-7-15(21)16(22)10-12/h6-7,10,21-22H,2-5,8-9H2,1H3,(H,18,19,20) |
| InChIKey | CZTDSFNLTHHPOU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|