C17H17N3O2 — CID 133349192
4-[2-[(5-methylquinazolin-4-yl)amino]ethyl]benzene-1,2-diol (PubChem CID 133349192) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[2-[(5-methylquinazolin-4-yl)amino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[(5-methylquinazolin-4-yl)amino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 133349192 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[2-[(5-methylquinazolin-4-yl)amino]ethyl]benzene-1,2-diol |
| SMILES | Cc1cccc2ncnc(NCCc3ccc(O)c(O)c3)c12 |
| InChI | InChI=1S/C17H17N3O2/c1-11-3-2-4-13-16(11)17(20-10-19-13)18-8-7-12-5-6-14(21)15(22)9-12/h2-6,9-10,21-22H,7-8H2,1H3,(H,18,19,20) |
| InChIKey | NPAIWTXECQKCDT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|