C19H21FN4 — CID 133411366
N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-methylquinazolin-4-amine (PubChem CID 133411366) has the molecular formula C19H21FN4 and a molecular weight of 324.40 g/mol. Its IUPAC name is N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-methylquinazolin-4-amine.
| Compound Name | N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 133411366 |
| Molecular Formula | C19H21FN4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-methylquinazolin-4-amine |
| SMILES | Cc1cccc2ncnc(NCc3ccc(CN(C)C)c(F)c3)c12 |
| InChI | InChI=1S/C19H21FN4/c1-13-5-4-6-17-18(13)19(23-12-22-17)21-10-14-7-8-15(11-24(2)3)16(20)9-14/h4-9,12H,10-11H2,1-3H3,(H,21,22,23) |
| InChIKey | MCKBTGBNLISMKS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |