C18H18BrFN4 — CID 133314883
6-bromo-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]quinazolin-4-amine (PubChem CID 133314883) has the molecular formula C18H18BrFN4 and a molecular weight of 389.27 g/mol. Its IUPAC name is 6-bromo-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133314883 |
| Molecular Formula | C18H18BrFN4 |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 6-bromo-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]quinazolin-4-amine |
| SMILES | CN(C)Cc1cc(CNc2ncnc3ccc(Br)cc23)ccc1F |
| InChI | InChI=1S/C18H18BrFN4/c1-24(2)10-13-7-12(3-5-16(13)20)9-21-18-15-8-14(19)4-6-17(15)22-11-23-18/h3-8,11H,9-10H2,1-2H3,(H,21,22,23) |
| InChIKey | ZCFMLGAIPCBMDQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |