C18H20BrN5O — CID 133431334
6-bromo-N-[[2-[2-(dimethylamino)ethoxy]-4-pyridinyl]methyl]quinazolin-4-amine (PubChem CID 133431334) has the molecular formula C18H20BrN5O and a molecular weight of 402.30 g/mol. Its IUPAC name is 6-bromo-N-[[2-[2-(dimethylamino)ethoxy]-4-pyridinyl]methyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[[2-[2-(dimethylamino)ethoxy]-4-pyridinyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133431334 |
| Molecular Formula | C18H20BrN5O |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 6-bromo-N-[[2-[2-(dimethylamino)ethoxy]-4-pyridinyl]methyl]quinazolin-4-amine |
| SMILES | CN(C)CCOc1cc(CNc2ncnc3ccc(Br)cc23)ccn1 |
| InChI | InChI=1S/C18H20BrN5O/c1-24(2)7-8-25-17-9-13(5-6-20-17)11-21-18-15-10-14(19)3-4-16(15)22-12-23-18/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,21,22,23) |
| InChIKey | BPKHFEYBRSXNIK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |