C16H17F4N3 — CID 133411320
N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 133411320) has the molecular formula C16H17F4N3 and a molecular weight of 327.33 g/mol. Its IUPAC name is N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133411320 |
| Molecular Formula | C16H17F4N3 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CN(C)Cc1ccc(CNc2ccc(C(F)(F)F)cn2)cc1F |
| InChI | InChI=1S/C16H17F4N3/c1-23(2)10-12-4-3-11(7-14(12)17)8-21-15-6-5-13(9-22-15)16(18,19)20/h3-7,9H,8,10H2,1-2H3,(H,21,22) |
| InChIKey | MNNPOASVYNAXSP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |