C19H20FN3O2 — CID 55854206
5-fluoro-N-[(3-methoxy-4-propoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 55854206) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-fluoro-N-[(3-methoxy-4-propoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 5-fluoro-N-[(3-methoxy-4-propoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 55854206 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-fluoro-N-[(3-methoxy-4-propoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | CCCOc1ccc(CNc2ncnc3cccc(F)c23)cc1OC |
| InChI | InChI=1S/C19H20FN3O2/c1-3-9-25-16-8-7-13(10-17(16)24-2)11-21-19-18-14(20)5-4-6-15(18)22-12-23-19/h4-8,10,12H,3,9,11H2,1-2H3,(H,21,22,23) |
| InChIKey | HYUCKYHLXAMPMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |