C17H18N2O3 — CID 70111216
4-[2-(quinolin-4-ylamino)ethyl]benzene-1,2-diol;hydrate (PubChem CID 70111216) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[2-(quinolin-4-ylamino)ethyl]benzene-1,2-diol;hydrate.
| Compound Name | 4-[2-(quinolin-4-ylamino)ethyl]benzene-1,2-diol;hydrate |
|---|---|
| PubChem CID | 70111216 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[2-(quinolin-4-ylamino)ethyl]benzene-1,2-diol;hydrate |
| SMILES | O.Oc1ccc(CCNc2ccnc3ccccc23)cc1O |
| InChI | InChI=1S/C17H16N2O2.H2O/c20-16-6-5-12(11-17(16)21)7-9-18-15-8-10-19-14-4-2-1-3-13(14)15;/h1-6,8,10-11,20-21H,7,9H2,(H,18,19);1H2 |
| InChIKey | VGMKMFUREGPNCD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|