C21H19ClN2O2 — CID 53464134
4-[2-(acridin-10-ium-9-ylamino)ethyl]benzene-1,2-diol chloride (PubChem CID 53464134) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 4-[2-(acridin-10-ium-9-ylamino)ethyl]benzene-1,2-diol chloride.
| Compound Name | 4-[2-(acridin-10-ium-9-ylamino)ethyl]benzene-1,2-diol chloride |
|---|---|
| PubChem CID | 53464134 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-[2-(acridin-10-ium-9-ylamino)ethyl]benzene-1,2-diol chloride |
| SMILES | Oc1ccc(CCNc2c3ccccc3[nH+]c3ccccc23)cc1O.[Cl-] |
| InChI | InChI=1S/C21H18N2O2.ClH/c24-19-10-9-14(13-20(19)25)11-12-22-21-15-5-1-3-7-17(15)23-18-8-4-2-6-16(18)21;/h1-10,13,24-25H,11-12H2,(H,22,23);1H |
| InChIKey | MDVWCFHFBAZYEF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|