C17H17ClN4O — CID 133317003
4-[(6-chloro-3-cyanoquinolin-4-yl)amino]-N-cyclopropylbutanamide (PubChem CID 133317003) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-[(6-chloro-3-cyanoquinolin-4-yl)amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(6-chloro-3-cyanoquinolin-4-yl)amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 133317003 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[(6-chloro-3-cyanoquinolin-4-yl)amino]-N-cyclopropylbutanamide |
| SMILES | N#Cc1cnc2ccc(Cl)cc2c1NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C17H17ClN4O/c18-12-3-6-15-14(8-12)17(11(9-19)10-21-15)20-7-1-2-16(23)22-13-4-5-13/h3,6,8,10,13H,1-2,4-5,7H2,(H,20,21)(H,22,23) |
| InChIKey | QSQJQCIMBVFWIW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|