C16H17ClN4O2S2 — CID 133320646
6-chloro-4-(2-thiomorpholin-4-ylsulfonylethylamino)quinoline-3-carbonitrile (PubChem CID 133320646) has the molecular formula C16H17ClN4O2S2 and a molecular weight of 396.93 g/mol. Its IUPAC name is 6-chloro-4-(2-thiomorpholin-4-ylsulfonylethylamino)quinoline-3-carbonitrile.
| Compound Name | 6-chloro-4-(2-thiomorpholin-4-ylsulfonylethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133320646 |
| Molecular Formula | C16H17ClN4O2S2 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 6-chloro-4-(2-thiomorpholin-4-ylsulfonylethylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(Cl)cc2c1NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H17ClN4O2S2/c17-13-1-2-15-14(9-13)16(12(10-18)11-20-15)19-3-8-25(22,23)21-4-6-24-7-5-21/h1-2,9,11H,3-8H2,(H,19,20) |
| InChIKey | GJBJBLWWCRBSGA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |