C22H18ClN5O2 — CID 133318327
6-chloro-4-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methylamino]quinoline-3-carbonitrile (PubChem CID 133318327) has the molecular formula C22H18ClN5O2 and a molecular weight of 419.87 g/mol. Its IUPAC name is 6-chloro-4-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methylamino]quinoline-3-carbonitrile.
| Compound Name | 6-chloro-4-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133318327 |
| Molecular Formula | C22H18ClN5O2 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 6-chloro-4-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methylamino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(Cl)cc2c1NCc1ccc(C(=O)N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C22H18ClN5O2/c23-17-5-6-19-18(9-17)21(16(10-24)12-26-19)27-11-14-1-3-15(4-2-14)22(30)28-8-7-25-20(29)13-28/h1-6,9,12H,7-8,11,13H2,(H,25,29)(H,26,27) |
| InChIKey | WZHPANQRVXGGRI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |