C18H19N3OS — CID 133317628
N-propyl-3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]benzamide (PubChem CID 133317628) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-propyl-3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]benzamide.
| Compound Name | N-propyl-3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]benzamide |
|---|---|
| PubChem CID | 133317628 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-propyl-3-[(thieno[3,2-b]pyridin-7-ylamino)methyl]benzamide |
| SMILES | CCCNC(=O)c1cccc(CNc2ccnc3ccsc23)c1 |
| InChI | InChI=1S/C18H19N3OS/c1-2-8-20-18(22)14-5-3-4-13(11-14)12-21-15-6-9-19-16-7-10-23-17(15)16/h3-7,9-11H,2,8,12H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | GVHWMDQIUNYHLW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |