C18H19Cl3N4O — CID 133320120
4-chloro-2-(2,4-dichlorophenyl)-5-[(1-prop-2-enylpiperidin-4-yl)amino]pyridazin-3-one (PubChem CID 133320120) has the molecular formula C18H19Cl3N4O and a molecular weight of 413.74 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dichlorophenyl)-5-[(1-prop-2-enylpiperidin-4-yl)amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2,4-dichlorophenyl)-5-[(1-prop-2-enylpiperidin-4-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 133320120 |
| Molecular Formula | C18H19Cl3N4O |
| Molecular Weight | 413.74 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-chloro-2-(2,4-dichlorophenyl)-5-[(1-prop-2-enylpiperidin-4-yl)amino]pyridazin-3-one |
| SMILES | C=CCN1CCC(Nc2cnn(-c3ccc(Cl)cc3Cl)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl3N4O/c1-2-7-24-8-5-13(6-9-24)23-15-11-22-25(18(26)17(15)21)16-4-3-12(19)10-14(16)20/h2-4,10-11,13,23H,1,5-9H2 |
| InChIKey | UFAYHBDVYKVRCU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|