C16H16Cl3N3O2 — CID 133366350
4-chloro-2-(2,4-dichlorophenyl)-5-[2-(2-methylprop-2-enoxy)ethylamino]pyridazin-3-one (PubChem CID 133366350) has the molecular formula C16H16Cl3N3O2 and a molecular weight of 388.68 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dichlorophenyl)-5-[2-(2-methylprop-2-enoxy)ethylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2,4-dichlorophenyl)-5-[2-(2-methylprop-2-enoxy)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 133366350 |
| Molecular Formula | C16H16Cl3N3O2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 4-chloro-2-(2,4-dichlorophenyl)-5-[2-(2-methylprop-2-enoxy)ethylamino]pyridazin-3-one |
| SMILES | C=C(C)COCCNc1cnn(-c2ccc(Cl)cc2Cl)c(=O)c1Cl |
| InChI | InChI=1S/C16H16Cl3N3O2/c1-10(2)9-24-6-5-20-13-8-21-22(16(23)15(13)19)14-4-3-11(17)7-12(14)18/h3-4,7-8,20H,1,5-6,9H2,2H3 |
| InChIKey | KOXRBHGKRCTCLX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|