C16H16Cl4N4O2 — CID 2774919
3-chloro-N'-[5-chloro-1-(2,4-dichlorophenyl)-6-oxopyridazin-4-yl]-N',2,2-trimethylpropanehydrazide (PubChem CID 2774919) has the molecular formula C16H16Cl4N4O2 and a molecular weight of 438.14 g/mol. Its IUPAC name is 3-chloro-N'-[5-chloro-1-(2,4-dichlorophenyl)-6-oxopyridazin-4-yl]-N',2,2-trimethylpropanehydrazide.
| Compound Name | 3-chloro-N'-[5-chloro-1-(2,4-dichlorophenyl)-6-oxopyridazin-4-yl]-N',2,2-trimethylpropanehydrazide |
|---|---|
| PubChem CID | 2774919 |
| Molecular Formula | C16H16Cl4N4O2 |
| Molecular Weight | 438.14 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 3-chloro-N'-[5-chloro-1-(2,4-dichlorophenyl)-6-oxopyridazin-4-yl]-N',2,2-trimethylpropanehydrazide |
| SMILES | CN(NC(=O)C(C)(C)CCl)c1cnn(-c2ccc(Cl)cc2Cl)c(=O)c1Cl |
| InChI | InChI=1S/C16H16Cl4N4O2/c1-16(2,8-17)15(26)22-23(3)12-7-21-24(14(25)13(12)20)11-5-4-9(18)6-10(11)19/h4-7H,8H2,1-3H3,(H,22,26) |
| InChIKey | TYAZBYMWMQDEBW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|