C12H18ClN3O2 — CID 114264802
4-chloro-2-propan-2-yl-5-(2-prop-2-enoxyethylamino)pyridazin-3-one (PubChem CID 114264802) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 4-chloro-2-propan-2-yl-5-(2-prop-2-enoxyethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-propan-2-yl-5-(2-prop-2-enoxyethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114264802 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-chloro-2-propan-2-yl-5-(2-prop-2-enoxyethylamino)pyridazin-3-one |
| SMILES | C=CCOCCNc1cnn(C(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C12H18ClN3O2/c1-4-6-18-7-5-14-10-8-15-16(9(2)3)12(17)11(10)13/h4,8-9,14H,1,5-7H2,2-3H3 |
| InChIKey | KIFAMHNHHRMUDA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|