C14H13F3N4O2S — CID 133320917
3-[3-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]propyl]imidazolidine-2,4-dione (PubChem CID 133320917) has the molecular formula C14H13F3N4O2S and a molecular weight of 358.35 g/mol. Its IUPAC name is 3-[3-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 133320917 |
| Molecular Formula | C14H13F3N4O2S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-[3-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCNc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C14H13F3N4O2S/c15-14(16,17)8-2-3-10-9(6-8)20-12(24-10)18-4-1-5-21-11(22)7-19-13(21)23/h2-3,6H,1,4-5,7H2,(H,18,20)(H,19,23) |
| InChIKey | UQPKRCBYMNSWGM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|