C17H19FN4O2 — CID 133321682
2-[3-[(4-fluorobenzoyl)amino]propylamino]-N-methylpyridine-3-carboxamide (PubChem CID 133321682) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[3-[(4-fluorobenzoyl)amino]propylamino]-N-methylpyridine-3-carboxamide.
| Compound Name | 2-[3-[(4-fluorobenzoyl)amino]propylamino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133321682 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[3-[(4-fluorobenzoyl)amino]propylamino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cccnc1NCCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN4O2/c1-19-17(24)14-4-2-9-20-15(14)21-10-3-11-22-16(23)12-5-7-13(18)8-6-12/h2,4-9H,3,10-11H2,1H3,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | ZQPYSDCIHSBOAP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|