C17H22N4O — CID 133321766
5-[2-(4-ethenylpiperidin-1-yl)-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 133321766) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-[2-(4-ethenylpiperidin-1-yl)-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[2-(4-ethenylpiperidin-1-yl)-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133321766 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-[2-(4-ethenylpiperidin-1-yl)-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | C=CC1CCN(c2cc(-c3nc(C(C)C)no3)ccn2)CC1 |
| InChI | InChI=1S/C17H22N4O/c1-4-13-6-9-21(10-7-13)15-11-14(5-8-18-15)17-19-16(12(2)3)20-22-17/h4-5,8,11-13H,1,6-7,9-10H2,2-3H3 |
| InChIKey | YPYSRXQFALOPGP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|