C20H25N7O — CID 133320315
5-[2-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 133320315) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 5-[2-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[2-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133320315 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 5-[2-[3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)piperidin-1-yl]-4-pyridinyl]-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1noc(-c2ccnc(N3CCCC(c4nnc5n4CCC5)C3)c2)n1 |
| InChI | InChI=1S/C20H25N7O/c1-13(2)18-22-20(28-25-18)14-7-8-21-17(11-14)26-9-3-5-15(12-26)19-24-23-16-6-4-10-27(16)19/h7-8,11,13,15H,3-6,9-10,12H2,1-2H3 |
| InChIKey | IPVJTOOBPMJEKF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |