C19H26N4OS — CID 133322669
N-cyclohex-3-en-1-yl-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133322669) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclohex-3-en-1-yl-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133322669 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-cyclohex-3-en-1-yl-5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(CN3CCOCC3)nc(NC3CC=CCC3)c2c1C |
| InChI | InChI=1S/C19H26N4OS/c1-13-14(2)25-19-17(13)18(20-15-6-4-3-5-7-15)21-16(22-19)12-23-8-10-24-11-9-23/h3-4,15H,5-12H2,1-2H3,(H,20,21,22) |
| InChIKey | VPNFPOCMILHALQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|