C18H25N3O2S — CID 133322948
2-(3-piperidin-1-ylsulfonyl-2-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 133322948) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-(3-piperidin-1-ylsulfonyl-2-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-(3-piperidin-1-ylsulfonyl-2-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 133322948 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-(3-piperidin-1-ylsulfonyl-2-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | O=S(=O)(c1cccnc1N1CC2CC=CCC2C1)N1CCCCC1 |
| InChI | InChI=1S/C18H25N3O2S/c22-24(23,21-11-4-1-5-12-21)17-9-6-10-19-18(17)20-13-15-7-2-3-8-16(15)14-20/h2-3,6,9-10,15-16H,1,4-5,7-8,11-14H2 |
| InChIKey | JFGBGUJDNKWMKS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|