C19H19N5 — CID 133322991
6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 133322991) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 133322991 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | C1=CCC2CN(c3ccc4nnc(-c5ccccc5)n4n3)CC2C1 |
| InChI | InChI=1S/C19H19N5/c1-2-6-14(7-3-1)19-21-20-17-10-11-18(22-24(17)19)23-12-15-8-4-5-9-16(15)13-23/h1-7,10-11,15-16H,8-9,12-13H2 |
| InChIKey | HGXPFYRXZGCADF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|