C19H22F2N6O2 — CID 133325708
N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133325708) has the molecular formula C19H22F2N6O2 and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133325708 |
| Molecular Formula | C19H22F2N6O2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-5-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COCc1cc(NC2CCCN(c3ccc(OC(F)F)cc3)C2)n2ncnc2n1 |
| InChI | InChI=1S/C19H22F2N6O2/c1-28-11-14-9-17(27-19(25-14)22-12-23-27)24-13-3-2-8-26(10-13)15-4-6-16(7-5-15)29-18(20)21/h4-7,9,12-13,18,24H,2-3,8,10-11H2,1H3 |
| InChIKey | PGDWJAJSZBPRAJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|