C21H27F2N5O2 — CID 133325726
[1-[6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 133325726) has the molecular formula C21H27F2N5O2 and a molecular weight of 419.48 g/mol. Its IUPAC name is [1-[6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 133325726 |
| Molecular Formula | C21H27F2N5O2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [1-[6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1cc(NC2CCCN(c3ccc(OC(F)F)cc3)C2)ncn1 |
| InChI | InChI=1S/C21H27F2N5O2/c22-21(23)30-18-7-5-16(6-8-18)27-9-1-3-15(12-27)26-19-11-20(25-14-24-19)28-10-2-4-17(28)13-29/h5-8,11,14-15,17,21,29H,1-4,9-10,12-13H2,(H,24,25,26) |
| InChIKey | DIEXGPNURAAKMX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|