C21H22F2N4O2 — CID 133325717
6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 133325717) has the molecular formula C21H22F2N4O2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133325717 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 6-[[1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(NC2CCCN(c3ccc(OC(F)F)cc3)C2)nc1 |
| InChI | InChI=1S/C21H22F2N4O2/c1-2-11-24-20(28)15-5-10-19(25-13-15)26-16-4-3-12-27(14-16)17-6-8-18(9-7-17)29-21(22)23/h1,5-10,13,16,21H,3-4,11-12,14H2,(H,24,28)(H,25,26) |
| InChIKey | QDPWJKUEPSLQLR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|