C17H21F3N4O — CID 133486904
N-prop-2-ynyl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide (PubChem CID 133486904) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is N-prop-2-ynyl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide.
| Compound Name | N-prop-2-ynyl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133486904 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-prop-2-ynyl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(NCC2CCN(CC(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C17H21F3N4O/c1-2-7-21-16(25)14-3-4-15(23-11-14)22-10-13-5-8-24(9-6-13)12-17(18,19)20/h1,3-4,11,13H,5-10,12H2,(H,21,25)(H,22,23) |
| InChIKey | POGCFDSQJARZOH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|