C16H21N5O — CID 133399815
6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 133399815) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133399815 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 6-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(NCC2CN3CCN2CC3)nc1 |
| InChI | InChI=1S/C16H21N5O/c1-2-5-17-16(22)13-3-4-15(18-10-13)19-11-14-12-20-6-8-21(14)9-7-20/h1,3-4,10,14H,5-9,11-12H2,(H,17,22)(H,18,19) |
| InChIKey | QKQUCGQLZUGPEU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|