C16H18N4OS — CID 133325827
6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 133325827) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133325827 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 6-[2-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(NCCc2ncc(CC)s2)nc1 |
| InChI | InChI=1S/C16H18N4OS/c1-3-8-18-16(21)12-5-6-14(19-10-12)17-9-7-15-20-11-13(4-2)22-15/h1,5-6,10-11H,4,7-9H2,2H3,(H,17,19)(H,18,21) |
| InChIKey | JSZSQEIROMJGHO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|