C16H18F2N4O2 — CID 96568176
N-[(3R)-1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-1H-pyrazole-5-carboxamide (PubChem CID 96568176) has the molecular formula C16H18F2N4O2 and a molecular weight of 336.34 g/mol. Its IUPAC name is N-[(3R)-1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3R)-1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 96568176 |
| Molecular Formula | C16H18F2N4O2 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[(3R)-1-[4-(difluoromethoxy)phenyl]piperidin-3-yl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCN(c2ccc(OC(F)F)cc2)C1)c1ccn[nH]1 |
| InChI | InChI=1S/C16H18F2N4O2/c17-16(18)24-13-5-3-12(4-6-13)22-9-1-2-11(10-22)20-15(23)14-7-8-19-21-14/h3-8,11,16H,1-2,9-10H2,(H,19,21)(H,20,23)/t11-/m1/s1 |
| InChIKey | CNMFTDVFFRCMBT-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|